CAS 856703-83-8

[4-(8-azabicyclo[3.2.1]octan-3-yl)-5-isopropyl-1,2,4-triazol-3-yl]methanol

Description:

The chemical substance known as [4-(8-azabicyclo[3.2.1]octan-3-yl)-5-isopropyl-1,2,4-triazol-3-yl]methanol, with the CAS number 856703-83-8, is a complex organic compound characterized by its unique bicyclic structure and the presence of a triazole ring. This compound features a bicyclic amine moiety, which contributes to its potential biological activity, particularly in pharmacological applications. The isopropyl group enhances its lipophilicity, potentially influencing its absorption and distribution in biological systems. The methanol functional group may impart solubility in polar solvents and could be involved in hydrogen bonding interactions. Overall, the structural features of this compound suggest it may exhibit interesting properties, making it a candidate for further investigation in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific interactions and efficacy would require detailed experimental studies to elucidate its potential applications.

Formula: C₁₃H₂₂N₄O

InChI: InChI=1/C13H22N4O/c1-8(2)13-16-15-12(7-18)17(13)11-5-9-3-4-10(6-11)14-9/h8-11,14,18H,3-7H2,1-2H3

SMILES: CC(C)c1nnc(CO)n1C1CC2CCC(C1)N2

Des[1-(4,4-difluorocyclohexanecarboxamido)-1-phenylpropyl]-3-hydroxymethyl Maraviroc

Controlled Product

CAS: 856703-83-8

Applications A metabolite of Maraviroc.
References Beaumont, K., et al.: Eur. J. Pharm. Sci., 12, 41 (2000), Walker, D.K., et al.: Drug Metab. Dispos., 33, 587 (2005).

Formula: C₁₃H₂₂N₄O

Color and Shape: Neat

Molecular weight: 250.34

Ref: TR-D288815