CAS 856758-57-1
:(αR)-4-(Difluoromethoxy)-α-methylbenzenemethanamine
Description:
(αR)-4-(Difluoromethoxy)-α-methylbenzenemethanamine, with the CAS number 856758-57-1, is a chemical compound characterized by its unique molecular structure, which includes a difluoromethoxy group and an α-methylbenzene moiety. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The difluoromethoxy substituent may influence its lipophilicity and reactivity, potentially enhancing its biological activity or interaction with specific receptors. The stereochemistry indicated by the (αR) designation suggests that the compound has a specific spatial arrangement, which can significantly affect its pharmacological properties and interactions in biological systems. Additionally, the presence of fluorine atoms often imparts unique characteristics, such as increased metabolic stability and altered solubility. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing selective agents for therapeutic applications.
Formula:C9H11F2NO
InChI:InChI=1S/C9H11F2NO/c1-6(12)7-2-4-8(5-3-7)13-9(10)11/h2-6,9H,12H2,1H3/t6-/m1/s1
InChI key:InChIKey=RTLQRHINHVOHHH-ZCFIWIBFSA-N
SMILES:O(C(F)F)C1=CC=C([C@@H](C)N)C=C1
Synonyms:- Benzenemethanamine, 4-(difluoromethoxy)-α-methyl-, (αR)-
- (αR)-4-(Difluoromethoxy)-α-methylbenzenemethanamine
- (1R)-1-[4-(Difluoromethoxy)phenyl]ethan-1-amine
- (R)-1-(4-(difluoromethoxy)phenyl)ethan-1-amine
- (R)-1-(4-(difluoromethoxy)phenyl)ethanamine
- (1R)-1-[4-(difluoromethoxy)phenyl]ethanamine
- 4-(difluoroMethoxy)-a-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.