CymitQuimica logo

CAS 85677-95-8

:

3-(2-Hydroxyethyl) 5-methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate

Description:
3-(2-Hydroxyethyl) 5-methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate, with the CAS number 85677-95-8, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with multiple functional groups, including a nitrophenyl group and ester functionalities, which contribute to its chemical reactivity and potential applications. The presence of hydroxyl and ester groups suggests that it may exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the compound's structure indicates potential biological activity, which may be explored in pharmaceutical or agrochemical contexts. Its molecular configuration allows for various interactions, making it a candidate for further research in medicinal chemistry or as a synthetic intermediate. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity associated with nitro groups and other reactive functionalities.
Formula:C18H20N2O7
InChI:InChI=1S/C18H20N2O7/c1-10-14(17(22)26-3)16(12-5-4-6-13(9-12)20(24)25)15(11(2)19-10)18(23)27-8-7-21/h4-6,9,16,19,21H,7-8H2,1-3H3
InChI key:InChIKey=OFTWHTCEEWIQLZ-UHFFFAOYSA-N
SMILES:C(OCCO)(=O)C=1C(C(C(OC)=O)=C(C)NC1C)C2=CC(N(=O)=O)=CC=C2
Synonyms:
  • 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 2-hydroxyethyl methyl ester
  • 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-(2-hydroxyethyl) 5-methyl ester
  • 3-(2-Hydroxyethyl) 5-methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate
  • 3-(2-Hydroxyethyl) 5-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.