CAS 856796-87-7

[3,3′-Bipyridine]-5,5′-dicarboxylic acid

Description:

[3,3′-Bipyridine]-5,5′-dicarboxylic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 3-position, along with carboxylic acid functional groups at the 5-position of each ring. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the carboxylic acid groups, which can also participate in hydrogen bonding. The dicarboxylic acid functionality allows for potential reactivity in various chemical reactions, including esterification and amidation, making it useful in organic synthesis and coordination chemistry. Additionally, the bipyridine moiety can act as a ligand in metal coordination complexes, enhancing its applicability in catalysis and materials science. The compound may also exhibit interesting electronic properties due to the conjugated system formed by the pyridine rings, which can influence its behavior in electronic applications. Overall, [3,3′-Bipyridine]-5,5′-dicarboxylic acid is a versatile compound with significant potential in various chemical fields.

Formula: C₁₂H₈N₂O₄

InChI: InChI=1S/C12H8N2O4/c15-11(16)9-1-7(3-13-5-9)8-2-10(12(17)18)6-14-4-8/h1-6H,(H,15,16)(H,17,18)

InChI key: InChIKey=BDDJIOVNODRVCG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1)C=2C=C(C(O)=O)C=NC2

Synonyms:

• 5,5′-Binicotinic acid
• [3,3′-Bipyridine]-5,5′-dicarboxylic acid

[3,3'-Bipyridine]-5,5'-dicarboxylic acid

CAS: 856796-87-7

[3,3'-Bipyridine]-5,5'-dicarboxylic acid

Purity: 97%

Ref: 54-OR1039467

[3,3′-Bipyridine]-5,5′-dicarboxylic acid

CAS: 856796-87-7

Purity: 97%

Molecular weight: 244.2059937

Ref: 10-F696030