CAS 856835-53-5

Pyridine, 4-methyl-3-nitro-, hydrochloride (1:1)

Description:

Pyridine, 4-methyl-3-nitro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This specific compound features a methyl group and a nitro group positioned at the 4 and 3 positions of the pyridine ring, respectively. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable in various environments. Typically, pyridine derivatives exhibit properties such as being polar and capable of participating in hydrogen bonding due to the presence of the nitrogen atom. This compound may be utilized in various applications, including organic synthesis, pharmaceuticals, and as a reagent in chemical reactions. Safety considerations should be taken into account, as nitro compounds can be hazardous and may require proper handling and storage protocols. Overall, the unique functional groups present in this compound contribute to its reactivity and potential applications in chemical research and industry.

Formula: C₆H₇ClN₂O₂

InChI: InChI=1S/C6H6N2O2.ClH/c1-5-2-3-7-4-6(5)8(9)10;/h2-4H,1H3;1H

InChI key: InChIKey=YJYIFDJCITXAAZ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(C)=CC=NC1.Cl

Synonyms:

• 4-Picoline, 3-nitro-, hydrochloride
• Pyridine, 4-methyl-3-nitro-, hydrochloride (1:1)

4-Methyl-3-nitropyridine hydrochloride

CAS: 856835-53-5

Formula: C₆H₇ClN₂O₂

Purity: 95+%

Color and Shape: Solid

Molecular weight: 174.5850

Ref: IN-DA004Q5M

4-Methyl-3-nitropyridine hydrochloride

CAS: 856835-53-5

Formula: C₆H₇ClN₂O₂

Purity: 95.0%

Molecular weight: 174.58

Ref: 10-F234638

4-Methyl-3-nitropyridine hydrochloride

CAS: 856835-53-5

4-Methyl-3-nitropyridine hydrochloride is a chemical compound that is an intermediate in the synthesis of other compounds. It is a versatile building block for the synthesis of many different types of chemical compounds and can be used as a reagent for research purposes. 4-Methyl-3-nitropyridine hydrochloride can be used as a speciality chemical or as a reaction component. This compound has a high quality and is useful in the production of fine chemicals, pharmaceuticals, agrochemicals, and dyes.

Formula: C₆H₇ClN₂O₂

Molecular weight: 174.59 g/mol

Ref: 3D-M-4269