CAS 856835-98-8

5-Hydroxy-2-pyridinecarboxylic acid hydrazide

Description:

5-Hydroxy-2-pyridinecarboxylic acid hydrazide, also known by its CAS number 856835-98-8, is a chemical compound characterized by its hydrazide functional group attached to a pyridine ring. This compound typically exhibits properties associated with both hydrazides and pyridine derivatives, including potential biological activity. It may be soluble in polar solvents due to the presence of hydroxyl and carboxylic acid groups, which can facilitate hydrogen bonding. The compound's structure suggests it could participate in various chemical reactions, such as acylation or condensation, making it of interest in synthetic organic chemistry. Additionally, derivatives of pyridinecarboxylic acids are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The presence of the hydrazide moiety may also enhance its reactivity and potential applications in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be reviewed before use, as the biological effects and toxicity profiles can vary significantly based on the specific context of application.

Formula: C₆H₇N₃O₂

InChI: InChI=1S/C6H7N3O2/c7-9-6(11)5-2-1-4(10)3-8-5/h1-3,10H,7H2,(H,9,11)

InChI key: InChIKey=AILKVQXYFSGZLN-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=CC=C(O)C=N1

Synonyms:

• 2-Pyridinecarboxylic acid, 5-hydroxy-, hydrazide
• Picolinic acid, 5-hydroxy-, hydrazide
• 5-Hydroxy-2-pyridinecarboxylic acid hydrazide

2-Pyridinecarboxylicacid, 5-hydroxy-, hydrazide

CAS: 856835-98-8

Formula: C₆H₇N₃O₂

Purity: 97%

Molecular weight: 153.1387

Ref: IN-DA004PRI