CAS 856859-49-9

4-Bromo-1H-pyrazolo[3,4-b]pyridine

Description:

4-Bromo-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, with a bromine substituent at the 4-position of the pyrazole ring. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals targeting various diseases. The presence of the bromine atom can influence its reactivity and interactions with biological targets, making it a subject of interest in drug discovery. Additionally, its unique structural features contribute to its electronic properties, which can affect its behavior in chemical reactions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-1-2-8-6-4(5)3-9-10-6/h1-3H,(H,8,9,10)

SMILES: c1cnc2c(cn[nH]2)c1Br

4-Bromo-1H-pyrazolo[3,4-b]pyridine

CAS: 856859-49-9

Formula: C₆H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA0050HR

4-Bromo-1H-pyrazolo[3,4-b]pyridine

CAS: 856859-49-9

4-Bromo-1H-pyrazolo[3,4-b]pyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.02g/mol

Ref: 54-OR960576

4-Bromo-1H-pyrazolo[3,4-b]pyridine

CAS: 856859-49-9

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F076333