
CAS 856859-50-2
:4-Fluoro-1H-pyrazolo[3,4-b]pyridine
Description:
4-Fluoro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 4-position of the pyrazole ring enhances its reactivity and can influence its biological activity. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in polar organic solvents. It is often utilized in medicinal chemistry and drug development due to its potential as a pharmacophore in various therapeutic applications. The structure allows for diverse interactions with biological targets, making it a subject of interest in the synthesis of novel pharmaceuticals. Additionally, its stability under standard laboratory conditions and the ability to undergo various chemical transformations make it a valuable compound in research settings. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H4FN3
InChI:InChI=1S/C6H4FN3/c7-5-1-2-8-6-4(5)3-9-10-6/h1-3H,(H,8,9,10)
InChI key:InChIKey=CYJWGSIFCHXGAS-UHFFFAOYSA-N
SMILES:FC1=C2C(=NC=C1)NN=C2
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine, 4-fluoro-
- 4-Fluoro-1H-pyrazolo[3,4-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
