CAS 856859-51-3

4-Methyl-1H-pyrazolo[3,4-b]pyridine

Description:

4-Methyl-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings. This compound features a methyl group at the 4-position of the pyrazole ring, which influences its chemical reactivity and properties. It is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. The presence of nitrogen atoms in its structure contributes to its potential as a ligand in coordination chemistry and its biological activity, making it of interest in medicinal chemistry for its potential pharmacological applications. The compound may exhibit various functional properties, including the ability to participate in hydrogen bonding and π-π stacking interactions, which can affect its behavior in biological systems. Additionally, its unique structure allows for potential modifications that can enhance its activity or selectivity in various chemical reactions or biological targets. Overall, 4-Methyl-1H-pyrazolo[3,4-b]pyridine is a compound of interest in both synthetic and medicinal chemistry due to its distinctive structural features and potential applications.

Formula: C₇H₇N₃

InChI: InChI=1S/C7H7N3/c1-5-2-3-8-7-6(5)4-9-10-7/h2-4H,1H3,(H,8,9,10)

InChI key: InChIKey=CVEAAUAFISZRDR-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC=C1)NN=C2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine, 4-methyl-
• 4-Methyl-1H-pyrazolo[3,4-b]pyridine