CAS 856869-57-3
:1-(7-Carboxyheptyl) 1,2-benzenedicarboxylate
Description:
1-(7-Carboxyheptyl) 1,2-benzenedicarboxylate, identified by its CAS number 856869-57-3, is an organic compound characterized by its complex structure, which includes a benzenedicarboxylate moiety and a heptyl chain with a carboxylic acid functional group. This compound typically exhibits properties associated with both hydrophilic and hydrophobic characteristics due to the presence of the carboxylic acid groups and the long hydrocarbon chain. It may be soluble in organic solvents while having limited solubility in water, depending on the pH and the presence of other ions. The carboxylic acid groups can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in various applications, including materials science, pharmaceuticals, and as a potential intermediate in organic synthesis. Its specific reactivity and stability would depend on the surrounding conditions, such as temperature and pH, as well as the presence of other chemical species.
Formula:C16H20O6
InChI:InChI=1S/C16H20O6/c17-14(18)10-4-2-1-3-7-11-22-16(21)13-9-6-5-8-12(13)15(19)20/h5-6,8-9H,1-4,7,10-11H2,(H,17,18)(H,19,20)
InChI key:InChIKey=MVSRWFURCUZTAM-UHFFFAOYSA-N
SMILES:C(OCCCCCCCC(O)=O)(=O)C1=C(C(O)=O)C=CC=C1
Synonyms:- Mono(7-carboxy-n-heptyl)phthalate
- 1,2-Benzenedicarboxylic acid, 1-(7-carboxyheptyl) ester
- 1-(7-Carboxyheptyl) 1,2-benzenedicarboxylate
- 1,2-Benzenedicarboxylic acid, mono(7-carboxyheptyl) ester
- Mono(7-carboxyheptyl)phthalate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
