CAS 85691-74-3
:Pirmagrel
Description:
Pirmagrel, identified by its CAS number 85691-74-3, is a chemical compound that functions primarily as a platelet aggregation inhibitor. It is classified as a thienopyridine derivative, which is a structural class known for its antiplatelet properties. Pirmagrel works by irreversibly inhibiting the P2Y12 receptor on platelets, thereby preventing platelet activation and aggregation, which is crucial in the management of cardiovascular diseases, particularly in preventing thrombotic events. The compound is typically administered in a pharmaceutical formulation and is often evaluated for its efficacy and safety in clinical settings. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are important for determining dosing regimens and potential interactions with other medications. As with many antiplatelet agents, monitoring for side effects such as bleeding complications is essential during treatment. Overall, Pirmagrel represents a significant advancement in the therapeutic strategies aimed at reducing the risk of cardiovascular events associated with platelet activation.
Formula:C13H16N2O2
InChI:InChI=1/C13H16N2O2/c16-13(17)8-3-1-2-5-11-6-4-7-12-9-14-10-15(11)12/h4,6-7,9-10H,1-3,5,8H2,(H,16,17)
SMILES:C(CCc1cccc2cncn12)CCC(=O)O
Synonyms:- Pirmagrel [USAN:INN]
- Pirmgrel
- Imidazo(1,5-a)pyridine-5-hexanoic acid
- Pirmagrelum
- Pirmagrelum [Latin]
- Unii-9J5H2Va91V
- 6-(Imidazo[1,5-A]Pyridin-5-Yl)Hexanoic Acid
