CAS 856925-72-9

1,2,3,9-Tetrahydro-6-methyl-1-phenyl-4H-pyrrolo[2,3-b]quinolin-4-one

Description:

1,2,3,9-Tetrahydro-6-methyl-1-phenyl-4H-pyrrolo[2,3-b]quinolin-4-one, with the CAS number 856925-72-9, is a synthetic organic compound characterized by its complex bicyclic structure that incorporates both pyrrole and quinoline moieties. This compound typically exhibits a solid-state at room temperature and is likely to be a pale yellow to brown crystalline substance. It is known for its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in medicinal chemistry. The presence of the methyl and phenyl groups contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. Its synthesis involves multi-step organic reactions, and it may serve as a scaffold for the development of novel pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₁₆N₂O

InChI: InChI=1S/C18H16N2O/c1-12-7-8-16-15(11-12)17(21)14-9-10-20(18(14)19-16)13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,19,21)

InChI key: InChIKey=RBHOGGBFJPVUJO-UHFFFAOYSA-N

SMILES: O=C1C2=C(N(CC2)C3=CC=CC=C3)NC=4C1=CC(C)=CC4

Synonyms:

• 1,2,3,9-Tetrahydro-6-methyl-1-phenyl-4H-pyrrolo[2,3-b]quinolin-4-one
• 4H-Pyrrolo[2,3-b]quinolin-4-one, 1,2,3,9-tetrahydro-6-methyl-1-phenyl-

Deoxy Blebbistatin

Controlled Product

CAS: 856925-72-9

Applications A derivative of Blebbistatin, a compound that blockes myosin II-dependent cell processes.
References Straight, A.F., et al.: Science, 299, 1743 (2003)

Formula: C₁₈H₁₆N₂O

Color and Shape: Neat

Molecular weight: 276.33

Ref: TR-D232550