CymitQuimica logo

CAS 856937-70-7

:

3-(Bromomethyl)-4-methylthiophene

Description:
3-(Bromomethyl)-4-methylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromomethyl group at the 3-position and a methyl group at the 4-position contributes to its unique reactivity and properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and ethanol, but has limited solubility in water due to its hydrophobic nature. The bromomethyl group makes it a useful intermediate in organic synthesis, allowing for further functionalization through nucleophilic substitution reactions. Additionally, the methylthiophene structure can impart interesting electronic properties, making it relevant in materials science, particularly in the development of organic semiconductors and conducting polymers. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, 3-(Bromomethyl)-4-methylthiophene serves as a valuable building block in synthetic organic chemistry.
Formula:C6H7BrS
InChI:InChI=1S/C6H7BrS/c1-5-3-8-4-6(5)2-7/h3-4H,2H2,1H3
InChI key:InChIKey=FUUFNEQFPCJOGE-UHFFFAOYSA-N
SMILES:C(Br)C=1C(C)=CSC1
Synonyms:
  • 3-(Bromomethyl)-4-methylthiophene
  • Thiophene, 3-(bromomethyl)-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.