CAS 85694-53-7

1,2,5-Thiadiazolidine, 2-cyclopentyl-, 1,1-dioxide

Description:

1,2,5-Thiadiazolidine, 2-cyclopentyl-, 1,1-dioxide, with CAS number 85694-53-7, is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. The structure features a thiadiazolidine ring, which is a derivative of thiadiazole, and includes a cyclopentyl group that contributes to its unique properties. This compound is known for its potential biological activity, particularly in medicinal chemistry, where it may exhibit antimicrobial or anti-inflammatory effects. The presence of the 1,1-dioxide functional group indicates that it has two oxygen atoms double-bonded to the sulfur atom, which can influence its reactivity and solubility. Generally, compounds of this type may be solid at room temperature and can be soluble in polar organic solvents. Due to its specific structural features, it may also participate in various chemical reactions, making it of interest for further research in synthetic and pharmaceutical chemistry.

Formula: C₇H₁₄N₂O₂S

InChI: InChI=1S/C7H14N2O2S/c10-12(11)8-5-6-9(12)7-3-1-2-4-7/h7-8H,1-6H2

InChI key: InChIKey=HXJVJYVRQDLZGE-UHFFFAOYSA-N

SMILES: O=S1(=O)N(CCN1)C2CCCC2

Synonyms:

• 1,2,5-Thiadiazolidine, 2-cyclopentyl-, 1,1-dioxide
• 2-Cyclopentyl-1,2,5-thiadiazolidine-1,1-dioxide