CymitQuimica logo

CAS 856965-37-2

:

2-Amino-5-hydroxypyridine hydrochloride

Description:
2-Amino-5-hydroxypyridine hydrochloride is an organic compound characterized by its pyridine ring structure, which features both an amino group (-NH2) and a hydroxyl group (-OH) at the 2 and 5 positions, respectively. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the amino and hydroxyl groups contributes to its potential as a building block in the synthesis of more complex molecules, as well as its ability to participate in hydrogen bonding, which can influence its reactivity and interactions with other substances. Additionally, 2-amino-5-hydroxypyridine may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other compounds. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C5H6N2OHCl
InChI:InChI=1S/C5H6N2O.ClH/c6-5-2-1-4(8)3-7-5;/h1-3,8H,(H2,6,7);1H
InChI key:VFVKEBQUEFKSMO-UHFFFAOYSA-N
SMILES:C1=CC(=NC=C1O)N.Cl
Synonyms:
  • 6-Amino-3-pyridinol hydrochloride
  • 6-Amino-pyridin-3-ol hydrochloride
Found 5 products.