CAS 856978-85-3

3-Amino-1-(5-chloro-2-thienyl)-1-propanone

Description:

3-Amino-1-(5-chloro-2-thienyl)-1-propanone is an organic compound characterized by its unique structural features, which include an amino group and a thienyl ring. The presence of the 5-chloro substituent on the thienyl ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties associated with both amines and ketones, such as the ability to participate in nucleophilic reactions due to the amino group and the carbonyl functionality of the ketone. It may also display moderate solubility in polar solvents, influenced by the amino group, while the thienyl ring can impart aromatic characteristics. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the thienyl moiety and the amino group, which can enhance biological interactions. As with many organic compounds, its stability and reactivity can be affected by environmental conditions such as pH and temperature.

Formula: C₇H₈ClNOS

InChI: InChI=1S/C7H8ClNOS/c8-7-2-1-6(11-7)5(10)3-4-9/h1-2H,3-4,9H2

InChI key: InChIKey=RIAXQIKCBWWYOT-UHFFFAOYSA-N

SMILES: C(CCN)(=O)C1=CC=C(Cl)S1

Synonyms:

• 3-Amino-1-(5-chloro-2-thienyl)-1-propanone
• 3-Amino-1-(5-chlorothiophen-2-yl)propan-1-one
• 1-Propanone, 3-amino-1-(5-chloro-2-thienyl)-