CAS 85698-56-2

N,N,N',N'-tetramethyl-2,2'-bipyridine-4,4'-diamine

Description:

N,N,N',N'-Tetramethyl-2,2'-bipyridine-4,4'-diamine, with the CAS number 85698-56-2, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features four methyl groups attached to the nitrogen atoms of the diamine functional groups, enhancing its solubility in organic solvents and contributing to its overall stability. It is typically a solid at room temperature and exhibits a high degree of thermal stability. The presence of the diamine functionality allows for potential applications in coordination chemistry, particularly in the formation of metal complexes. Additionally, the compound may exhibit interesting electrochemical properties due to the presence of the bipyridine moiety, making it a candidate for use in various chemical reactions and as a ligand in catalysis. Its unique structure and properties make it valuable in research and industrial applications, particularly in the fields of materials science and organic synthesis.

Formula: C₁₄H₁₈N₄

InChI: InChI=1/C14H18N4/c1-17(2)11-5-7-15-13(9-11)14-10-12(18(3)4)6-8-16-14/h5-10H,1-4H3

SMILES: CN(C)c1ccnc(c1)c1cc(ccn1)N(C)C

4,4-DiMethylaMino-2,2-bipyridine

CAS: 85698-56-2

Formula: C₁₄H₁₈N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.3195

Ref: IN-DA00G9EQ

N4,N4,N4',N4'-Tetramethyl-[2,2'-bipyridine]-4,4'-diamine

CAS: 85698-56-2

N4,N4,N4',N4'-Tetramethyl-[2,2'-bipyridine]-4,4'-diamine

Purity: 97%

Molecular weight: 242.32g/mol

Ref: 54-OR76630

4,4' -Bis(N,N-dimethylamino)-2,2' -bipyridine

CAS: 85698-56-2

4,4' -Bis(N,N-dimethylamino)-2,2' -bipyridine (DMAB) is a ligand that is used in electrochemical studies. It has been shown to have ancillary properties, which means that it does not interact directly with the substrate but modifies its environment. DMAB can form a complex with the proton at the electrode surface and x-ray crystal structures have been obtained for this interaction. These structures demonstrate that DMAB binds to the tetrazole ring of pyridine and stabilizes the molecule by increasing its redox potentials.

Formula: C₁₄H₁₈N₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 242.32 g/mol

Ref: 3D-FB161440

N4,N4,N4′,N4′-Tetramethyl-[2,2′-bipyridine]-4,4′-diamine

CAS: 85698-56-2

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.326004

Ref: 10-F634065

4,4'-Bis(N,N-dimethylamino)-2,2'-bipyridine (>90%)

Controlled Product

CAS: 85698-56-2

Formula: C₁₄H₁₈N₄

Purity: >90%

Color and Shape: Neat

Molecular weight: 242.32

Ref: TR-B015941

4,4' -Bis(N,N-dimethylamino)-2,2' -bipyridine

CAS: 85698-56-2

4,4'-Bis(N,N-dimethylamino)-2,2'-bipyridine is a high quality chemical used as an intermediate for the synthesis of other compounds. It is a complex compound that can be used as a reagent or in research to produce useful scaffolds and building blocks. 4,4'-Bis(N,N-dimethylamino)-2,2'-bipyridine can be used in reactions as a versatile building block.

Formula: C₁₄H₁₈N₄

Purity: Min. 98 Area-%

Molecular weight: 242.33 g/mol

Ref: 3D-J-400420