
CAS 85699-62-3
:(9aR)-6-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-7-methoxy-3a,4,9,9a-tetrahydronaphtho[2,3-c]furan-1(3H)-one
Description:
The chemical substance known as (9aR)-6-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-7-methoxy-3a,4,9,9a-tetrahydronaphtho[2,3-c]furan-1(3H)-one, with the CAS number 85699-62-3, is a complex organic compound characterized by its polycyclic structure, which includes a naphthoquinone core. This compound features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, which contribute to its chemical reactivity and potential biological activity. The presence of these substituents suggests that it may exhibit antioxidant properties or interact with various biological pathways. Its stereochemistry, indicated by the (9aR) configuration, implies specific spatial arrangements that can influence its interactions with biological targets. This compound may be of interest in medicinal chemistry and pharmacology due to its structural complexity and potential therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties, mechanisms of action, and potential uses in various fields, including drug development and natural product chemistry.
Formula:C20H20O6
InChI:InChI=1/C20H20O6/c1-24-17-6-10(3-4-15(17)21)19-12-8-16(22)18(25-2)7-11(12)5-13-14(19)9-26-20(13)23/h3-4,6-8,13-14,19,21-22H,5,9H2,1-2H3/t13-,14?,19?/m1/s1
SMILES:COc1cc(ccc1O)C1c2cc(c(cc2C[C@@H]2C1COC2=O)OC)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
α-Conidendrin
CAS:alpha-Conidendrin is a natural product of Tsuga, Pinaceae.Formula:C20H20O6Purity:98%Color and Shape:SolidMolecular weight:356.37α-Conidendrin
CAS:α-Conidendrin is a lignan compound, which is a class of phenolic dimers. It is primarily sourced from coniferous trees and other plant species. As a derivative of wood and plant material, α-Conidendrin is often extracted through processes involving the isolation of lignans from plant tissues. The mode of action of α-Conidendrin involves its antioxidant properties, where it scavenges harmful free radicals thus protecting cells from oxidative damage. This activity is crucial in understanding its potential biological roles and applications.
Formula:C20H20O6Purity:Min. 95%Molecular weight:356.4 g/mol




