![3-Oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol, 9-methyl-, hydrochloride (1:1), (1α,2β,4β,5α,7β)-](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F395791-3-oxa-9-azatricyclo-3-3-1-024-nonan-7-ol-9-methyl-hydrochloride-1-1-1a-2b-4b-5a-7b.webp&w=3840&q=75)
CAS 85700-55-6
:3-Oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol, 9-methyl-, hydrochloride (1:1), (1α,2β,4β,5α,7β)-
Description:
3-Oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol, 9-methyl-, hydrochloride (1:1), (1α,2β,4β,5α,7β)- is a chemical compound characterized by its unique bicyclic structure, which includes both nitrogen and oxygen heteroatoms. This compound features a tricyclic framework, indicative of its complex stereochemistry and potential for various interactions due to the presence of functional groups such as hydroxyl (-OH) and the hydrochloride salt form. The hydrochloride designation suggests that the compound is a salt formed with hydrochloric acid, which typically enhances its solubility in water and may influence its pharmacological properties. The specific stereochemistry (1α,2β,4β,5α,7β) indicates the spatial arrangement of atoms in the molecule, which is crucial for its biological activity and interaction with receptors. Compounds of this nature may exhibit a range of biological activities, making them of interest in medicinal chemistry and pharmacology. However, detailed studies would be necessary to elucidate its specific properties, mechanisms of action, and potential applications.
Formula:C8H13NO2·ClH
InChI:InChI=1/C8H13NO2.ClH/c1-9-5-2-4(10)3-6(9)8-7(5)11-8;/h4-8,10H,2-3H2,1H3;1H/t4-,5-,6+,7-,8+;
InChI key:InChIKey=BBBRAOXIMQHVCR-YSJWXMLMNA-N
SMILES:CN1[C@@]2([C@]3([C@](O3)([C@]1(C[C@@H](O)C2)[H])[H])[H])[H].Cl
Synonyms:- (1Α,2Β,4Β,5Α,7Β)-9-Methyl-3-Oxa-9-Azatricyclo[3.3.1.02.4]Nonan-7-Ol Hydrochloride
- 3-Oxa-9-azatricyclo[3.3.1.0<sup>2,4</sup>]nonan-7-ol, 9-methyl-, hydrochloride (1:1), (1α,2β,4β,5α,7β)-
- 3-Oxa-9-azatricyclo[3.3.1.0<sup>2,4</sup>]nonan-7-ol, 9-methyl-, hydrochloride, (1α,2β,4β,5α,7β)-
- 9-Methyl-3-Oxa-9-Azatricyclo[3.3.1.02,4]Nonan-7-Ol Hydrochloride (1:1)
- Scopine hydrochloride
- 3-Oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol, 9-methyl-, hydrochloride, (1α,2β,4β,5α,7β)-
- 3-Oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol, 9-methyl-, hydrochloride (1:1), (1α,2β,4β,5α,7β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Scopine hydrochloride
CAS:<p>Scopine hydrochloride (6,7-Epoxytropine hydrochloride) is the metabolite of anisodine, which is a α1-adrenergic receptor agonist.</p>Formula:C8H13NO2·HClPurity:98%Color and Shape:White PowderMolecular weight:191.66Scopine Hydrochloride
CAS:Controlled Product<p>Applications Intermediate in the production of Tiotropium Bromide, a long-acting bronchodilator.<br>References Buchwald, P., et al.: Pharmazie., 55, S210 (2000),<br></p>Formula:C8H13NO2·ClHColor and Shape:NeatMolecular weight:191.66Scopine hydrochloride
CAS:<p>Scopine hydrochloride is a chemical compound, which is a derivative of tropane alkaloids found primarily in plants like belladonna and other members of the Solanaceae family. It acts as an anticholinergic agent by blocking the action of acetylcholine on muscarinic receptors. This modulation of neurotransmitter activity can lead to effects such as the relaxation of smooth muscles, a decrease in bodily secretions, and dilation of the pupils.</p>Formula:C8H13NO2•HClPurity:Min. 95%Color and Shape:PowderMolecular weight:191.66 g/mol
