CAS 85700-75-0
:(11α,16β)-11,17,21-Trihydroxy-16-methylpregna-1,4-diene-3,20-dione
Description:
The chemical substance known as (11α,16β)-11,17,21-Trihydroxy-16-methylpregna-1,4-diene-3,20-dione, with the CAS number 85700-75-0, is a synthetic steroid that belongs to the class of corticosteroids. It is characterized by its complex steroidal structure, which includes multiple hydroxyl (-OH) groups that contribute to its biological activity. This compound exhibits anti-inflammatory and immunosuppressive properties, making it relevant in medical applications, particularly in the treatment of various inflammatory and autoimmune conditions. The presence of the diene and ketone functional groups in its structure enhances its reactivity and interaction with biological targets, such as steroid receptors. Additionally, its specific stereochemistry plays a crucial role in determining its pharmacological effects and potency. As a corticosteroid, it mimics the action of naturally occurring hormones produced by the adrenal cortex, influencing metabolism, immune response, and stress responses in the body. Overall, this compound is significant in both pharmaceutical research and therapeutic applications.
Formula:C22H30O5
InChI:InChI=1/C22H30O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-20(13,2)19(15)17(25)10-21(16,3)22(12,27)18(26)11-23/h6-7,9,12,15-17,19,23,25,27H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17+,19+,20-,21-,22-/m0/s1
InChI key:InChIKey=WNYLPFCKNQAAMB-OWUXUVPTSA-N
SMILES:C[C@@]12[C@]([C@]3([C@]([C@H](O)C1)([C@]4(C)C(CC3)=CC(=O)C=C4)[H])[H])(C[C@H](C)[C@@]2(C(CO)=O)O)[H]
Synonyms:- (11Alpha,16Beta)-11,17,21-Trihydroxy-16-Methylpregna-1,4-Diene-3,20-Dione
- (11α,16β)-11,17,21-Trihydroxy-16-methylpregna-1,4-diene-3,20-dione
- 288-238-3
- Pregna-1,4-diene-3,20-dione, 11,17,21-trihydroxy-16-methyl-, (11α,16β)-
- 16β-Methyl-11α,17,21-trihydroxypregna-1,4-diene-3,20-dione
- Betamethasone EP Impurity G
- 11β.17α.21-Trihydroxy-16α-methyl-pregnadien-(1.4)-dion-(3.20)
- (8S,9S,10R,11R,13S,14S,16S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-one
- 11alpha,17,21-trihydroxy-16beta-methylpregna-1,4-diene-3,20-dione
- Betamethasone Impurity 7(Betamethasone EP Impurity G)
- Einecs 288-238-3
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Betamethasone EP Impurity G
CAS:Formula:C22H30O5Color and Shape:White To Off-White SolidMolecular weight:374.48Betamethasone EP impurity G
CAS:Controlled ProductBetamethasone EP Impurity G is an analytical impurity that is found in the drug product Betamethasone EP. It is also a natural, synthetic, and custom synthesis impurity that has been manufactured to be an impurity standard. Betamethasone EP Impurity G has a CAS number of 85700-75-0 and is a niche HPLC standard for research and development purposes. This high purity impurity may be synthesized from other chemical compounds or created synthetically.
Formula:C22H30O5Purity:Min. 95%Color and Shape:PowderMolecular weight:374.5 g/molRef: 3D-IB180622
Discontinued product


