CymitQuimica logo

CAS 857020-56-5

:

6-amino-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid hydrochloride

Description:
6-Amino-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxine moiety. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The hydrochloride salt form enhances its solubility in aqueous solutions, making it suitable for various applications in pharmaceutical research and development. The presence of the amino group suggests potential for interactions with biological targets, while the carboxylic acid may participate in hydrogen bonding and ionic interactions. Its molecular structure indicates that it may exhibit properties such as moderate polarity and the ability to form salts, which can influence its pharmacokinetic profile. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation through empirical studies.
Formula:C9H10ClNO4
InChI:InChI=1/C9H9NO4.ClH/c10-6-4-8-7(13-1-2-14-8)3-5(6)9(11)12;/h3-4H,1-2,10H2,(H,11,12);1H
SMILES:C1COc2cc(c(cc2O1)C(=O)O)N.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.