CAS 857061-44-0

1-Bromo-3-chloro-2-(trifluoromethyl)benzene

Description:

1-Bromo-3-chloro-2-(trifluoromethyl)benzene is an aromatic halogenated compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, along with a trifluoromethyl group. This compound features a bromine atom at the first position, a chlorine atom at the third position, and a trifluoromethyl group (-CF3) at the second position of the benzene ring, contributing to its unique chemical properties. The presence of multiple halogens enhances its reactivity and can influence its physical properties, such as solubility and boiling point. Typically, halogenated aromatic compounds exhibit significant stability due to the resonance of the benzene ring, yet they can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The trifluoromethyl group is known for imparting lipophilicity and can affect the compound's biological activity. Overall, 1-Bromo-3-chloro-2-(trifluoromethyl)benzene is of interest in fields such as organic synthesis, materials science, and pharmaceuticals due to its unique structural features and potential applications.

Formula: C₇H₃BrClF₃

InChI: InChI=1/C7H3BrClF3/c8-4-2-1-3-5(9)6(4)7(10,11)12/h1-3H

SMILES: c1cc(c(c(c1)Cl)C(F)(F)F)Br

Synonyms:

• Benzene, 1-bromo-3-chloro-2-(trifluoromethyl)-
• 2-Bromo-6-Chlorobenzotrifluoride

2-Bromo-6-Chlorobenzotrifluoride

CAS: 857061-44-0

Formula: C₇H₃BrClF₃

Purity: 96%

Color and Shape: Liquid

Molecular weight: 259.4509

Ref: IN-DA003GQK

2-Bromo-6-chlorobenzotrifluoride

CAS: 857061-44-0

2-Bromo-6-chlorobenzotrifluoride

Formula: C₇H₃BrClF₃

Purity: 98%

Color and Shape: colourless liquid

Molecular weight: 259.45g/mol

Ref: 54-PC49063

2-Bromo-6-chlorobenzotrifluoride

CAS: 857061-44-0

Formula: C₇H₃BrClF₃

Purity: 96%

Color and Shape: Liquid, Clear

Molecular weight: 259.45

Ref: 10-F036196

1-bromo-3-chloro-2-(trifluoromethyl)benzene

CAS: 857061-44-0

Please enquire for more information about 1-bromo-3-chloro-2-(trifluoromethyl)benzene including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₃BrClF₃

Purity: Min. 95%

Molecular weight: 259.45 g/mol

Ref: 3D-FB106013