CAS 85710-39-0
:Aromadendrene epoxide
Description:
Aromadendrene epoxide is a bicyclic monoterpene epoxide derived from aromadendrene, a natural compound found in various essential oils. It is characterized by its unique structure, which includes an epoxide functional group, contributing to its reactivity and potential biological activity. Aromadendrene epoxide typically exhibits a pleasant, aromatic odor, making it of interest in the fragrance and flavor industries. Its chemical properties include being relatively hydrophobic, which influences its solubility in organic solvents rather than water. The compound may also possess antimicrobial and antifungal properties, which have been explored in various studies. Additionally, due to its epoxide group, it can participate in further chemical reactions, such as ring-opening reactions, which can lead to the formation of various derivatives. Overall, Aromadendrene epoxide is notable for its potential applications in natural product synthesis, perfumery, and possibly in therapeutic contexts, although further research is needed to fully understand its biological effects and applications.
Formula:C15H24O
InChI:InChI=1S/C15H24O/c1-9-4-5-10-12(9)13-11(14(13,2)3)6-7-15(10)8-16-15/h9-13H,4-8H2,1-3H3/t9-,10-,11-,12-,13-,15-/m1/s1
InChI key:InChIKey=XPGWKKLDFXNBPJ-QTPLKFIXSA-N
SMILES:C[C@H]1[C@@]2([C@]([C@]3(CO3)CC[C@@]4([C@]2(C4(C)C)[H])[H])(CC1)[H])[H]
Synonyms:- Aromadendrene epoxide
- Aromadendrene oxide
- Spiro[4H-cycloprop[e]azulene-4,2′-oxirane], decahydro-1,1,7-trimethyl-, (1aR,2′S,4aR,7R,7aS,7bS)-
- Spiro[4H-cycloprop[e]azulene-4,2′-oxirane], decahydro-1,1,7-trimethyl-, [1aR-(1aα,4β,4aα,7α,7aβ,7bα)]-
- (1aR,2′S,4aR,7R,7aS,7bS)-Decahydro-1,1,7-trimethylspiro[4H-cycloprop[e]azulene-4,2′-oxirane]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
