CAS 85711-14-4
:Cyclohexaneethanol, β-amino-, hydrochloride (1:1), (βR)-
Description:
Cyclohexaneethanol, β-amino-, hydrochloride (1:1), (βR)-, with CAS number 85711-14-4, is a chemical compound characterized by its structure that includes a cyclohexane ring and an amino alcohol functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility. The β-amino configuration indicates that the amino group is positioned on the β-carbon relative to the hydroxyl group, which can influence its biological activity and reactivity. Cyclohexaneethanol derivatives are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs that target the central nervous system. The hydrochloride salt form is commonly used to improve stability and bioavailability. As with many amines, it may exhibit basic properties, and its behavior in chemical reactions can be influenced by the presence of the amino and hydroxyl groups, making it a compound of interest in organic synthesis and medicinal chemistry.
Formula:C8H17NO·ClH
InChI:InChI=1S/C8H17NO.ClH/c9-8(6-10)7-4-2-1-3-5-7;/h7-8,10H,1-6,9H2;1H/t8-;/m0./s1
InChI key:InChIKey=PENLKJMHKAXHJP-QRPNPIFTSA-N
SMILES:[C@@H](CO)(N)C1CCCCC1.Cl
Synonyms:- Cyclohexaneethanol, β-amino-, hydrochloride, (βR)-
- (R)-2-Amino-2-cyclohexylethanol hydrochloride
- Cyclohexaneethanol, β-amino-, hydrochloride, (R)-
- Cyclohexaneethanol, β-amino-, hydrochloride (1:1), (βR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
