CymitQuimica logo

CAS 85711-89-3

:

Octane, ethylheptadecafluoro-

Description:
Octane, ethylheptadecafluoro- (CAS 85711-89-3) is a fluorinated hydrocarbon characterized by its long carbon chain and the presence of fluorine atoms, which significantly influence its chemical properties. This compound typically exhibits low volatility and high thermal stability due to the strong carbon-fluorine bonds. Its fluorinated nature imparts hydrophobic characteristics, making it resistant to water and many organic solvents. Octane, ethylheptadecafluoro- is often used in specialized applications, such as in the formulation of lubricants, surfactants, and in various industrial processes where chemical stability and resistance to degradation are crucial. Additionally, the presence of fluorine can enhance the compound's performance in certain applications, such as in fire-resistant materials. However, the environmental impact of fluorinated compounds is a concern, as they can persist in the environment and may contribute to ecological toxicity. Overall, this substance exemplifies the unique properties of fluorinated hydrocarbons, combining stability with specific functional characteristics suitable for niche applications.
Formula:C10H5F17
InChI:InChI=1/C10H5F17/c1-2-3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h2H2,1H3
SMILES:CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluorodecane
  • Octane, ethylheptadecafluoro-
  • Ethylheptadecafluorooctane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.