CAS 85712-04-5
:3,4-Dimethyl-1-heptanol
Description:
3,4-Dimethyl-1-heptanol is an organic compound classified as a fatty alcohol, characterized by its long carbon chain and the presence of hydroxyl (-OH) functional group. With the molecular formula C9H20O, it features a heptanol backbone with two methyl groups located at the 3rd and 4th carbon positions. This structure contributes to its hydrophobic nature, while the hydroxyl group imparts some degree of polarity, allowing for limited solubility in water. The compound is typically a colorless liquid at room temperature and exhibits a mild, pleasant odor. It is primarily used in the synthesis of surfactants, emulsifiers, and as a potential intermediate in organic synthesis. Additionally, 3,4-Dimethyl-1-heptanol may have applications in the fragrance industry due to its odor profile. Safety data indicates that, like many alcohols, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, its unique structure and properties make it a valuable compound in various chemical applications.
Formula:C9H20O
InChI:InChI=1S/C9H20O/c1-4-5-8(2)9(3)6-7-10/h8-10H,4-7H2,1-3H3
InChI key:InChIKey=TZWSLANDWSEXRD-UHFFFAOYSA-N
SMILES:C(C(CCO)C)(CCC)C
Synonyms:- 3,4-Dimethyl-1-heptanol
- 1-Heptanol, 3,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.