CymitQuimica logo

CAS 85712-05-6

:

2,5-Dimethyl-1-heptanol

Description:
2,5-Dimethyl-1-heptanol is an organic compound classified as a primary alcohol, characterized by its seven-carbon chain and two methyl groups located at the second and fifth positions. Its molecular formula is C9H20O, indicating the presence of a hydroxyl (-OH) functional group, which imparts typical alcohol properties such as solubility in water and the ability to participate in hydrogen bonding. This compound is typically a colorless liquid with a characteristic odor, and it is used in various applications, including as a solvent and in the synthesis of other organic compounds. The presence of the branched methyl groups contributes to its unique physical properties, such as lower boiling points compared to straight-chain alcohols of similar molecular weight. Additionally, 2,5-Dimethyl-1-heptanol may exhibit moderate toxicity and should be handled with care in laboratory settings. Its chemical behavior includes reactivity with acids to form esters and potential oxidation to ketones or aldehydes under certain conditions.
Formula:C9H20O
InChI:InChI=1S/C9H20O/c1-4-8(2)5-6-9(3)7-10/h8-10H,4-7H2,1-3H3
InChI key:InChIKey=ZEIZTVAKJXMCSQ-UHFFFAOYSA-N
SMILES:C(CCC(CO)C)(CC)C
Synonyms:
  • 2,5-Dimethyl-1-heptanol
  • 1-Heptanol, 2,5-dimethyl-
  • 2,5-Dimethylheptanol-1
Found 3 products.