CAS 85719-78-4
:4-[5-hydroxy-6-(2-hydroxy-3-methyl-4-methylidenetetrahydrofuran-2-yl)-1,3-dioxan-4-yl]piperidine-2,6-dione (non-preferred name)
Description:
The chemical substance known as 4-[5-hydroxy-6-(2-hydroxy-3-methyl-4-methylidenetetrahydrofuran-2-yl)-1,3-dioxan-4-yl]piperidine-2,6-dione, with the CAS number 85719-78-4, is a complex organic compound characterized by its multi-functional groups and cyclic structures. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a dioxane moiety that contributes to its structural diversity. The presence of hydroxyl groups indicates potential for hydrogen bonding, which can influence its solubility and reactivity. The compound's structure suggests it may exhibit biological activity, possibly as a pharmaceutical agent, due to the presence of multiple functional groups that can interact with biological targets. Its molecular configuration may also impart specific stereochemical properties, affecting its interaction with enzymes or receptors. Overall, this compound represents a class of molecules that could be of interest in medicinal chemistry and materials science, although detailed studies would be necessary to elucidate its specific properties and potential applications.
Formula:C15H21NO7
InChI:InChI=1/C15H21NO7/c1-7-5-23-15(20,8(7)2)14-12(19)13(21-6-22-14)9-3-10(17)16-11(18)4-9/h8-9,12-14,19-20H,1,3-6H2,2H3,(H,16,17,18)
SMILES:C=C1COC(C1C)(C1C(C(C2CC(=NC(=O)C2)O)OCO1)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

