CAS 85720-62-3
:[1,3]dithiolo[4,5-d][1,3]dithiol-2-one
Description:
[1,3]Dithiolo[4,5-d][1,3]dithiol-2-one, with the CAS number 85720-62-3, is a heterocyclic compound characterized by its unique structure that includes multiple sulfur atoms and a carbonyl group. This compound features a bicyclic arrangement, which contributes to its distinctive chemical properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific form. The presence of sulfur atoms in its structure often imparts notable reactivity, particularly in nucleophilic substitution reactions. Additionally, compounds of this type may demonstrate interesting electronic properties, making them potential candidates for applications in materials science and organic electronics. The compound's solubility can vary, often being soluble in polar organic solvents, which is relevant for its use in various chemical reactions and syntheses. Overall, [1,3]dithiolo[4,5-d][1,3]dithiol-2-one is a compound of interest in both synthetic chemistry and materials research due to its unique structural features and reactivity.
Formula:C4H2OS4
InChI:InChI=1/C4H2OS4/c5-4-8-2-3(9-4)7-1-6-2/h1H2
SMILES:C1Sc2c(S1)sc(=O)s2
Synonyms:- [1,3]Dithiolo[4,5-d][1,3]dithiol-2-one
- 1,3-dithiolo[4,5-d][1,3]dithiol-2-one
- 4,5-METHYLENEDITHIO-1,3-DITHIOL-2-ONE
- 4,5-Methylenedithio-1,3-dithiol-2-one>
- 4,5-Methylenedithio-1,3-Dithiol-2-Thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,5-Methylenedithio-1,3-dithiol-2-one
CAS:Formula:C4H2OS4Color and Shape:SolidMolecular weight:194.3181

