CAS 85720-78-1
:1,1,1,2,3,4,5,5,5-Nonafluoro-2-(trifluoromethyl)pentane
Description:
1,1,1,2,3,4,5,5,5-Nonafluoro-2-(trifluoromethyl)pentane, with CAS number 85720-78-1, is a perfluorinated compound characterized by a carbon chain that is fully fluorinated except for one carbon atom, which contains a trifluoromethyl group. This structure imparts unique properties, including high thermal and chemical stability, low surface tension, and low reactivity, making it useful in various applications such as specialty solvents and surfactants. The presence of multiple fluorine atoms contributes to its hydrophobic nature and resistance to degradation, which can raise environmental concerns regarding persistence. Additionally, this compound exhibits low volatility and high density, which can influence its behavior in different environments. Its unique characteristics make it a subject of interest in both industrial applications and environmental studies, particularly regarding its potential effects on human health and ecosystems. As with many perfluorinated compounds, regulatory scrutiny is increasing due to their environmental impact and bioaccumulation potential.
Formula:C6H2F12
InChI:InChI=1S/C6H2F12/c7-1(2(8)4(10,11)12)3(9,5(13,14)15)6(16,17)18/h1-2H
InChI key:InChIKey=JTAGPVKELVRAHG-UHFFFAOYSA-N
SMILES:C(C(C(C(F)(F)F)F)F)(C(F)(F)F)(C(F)(F)F)F
Synonyms:- 2-Trifluoromethyl-1,1,1,2,3,4,5,5,5-nonafluoropentane
- R 5312
- Pentane, 1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)-
- 1,1,1,2,3,4,5,5,5-Nonafluoro-2-(trifluoromethyl)pentane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.