
CAS 85721-30-8
:3-[Bis(1-methylethyl)amino]-1,2-propanediol
Description:
3-[Bis(1-methylethyl)amino]-1,2-propanediol, with the CAS number 85721-30-8, is an organic compound characterized by its structure, which includes a propanediol backbone substituted with a bis(1-methylethyl)amino group. This compound typically exhibits properties associated with amines and alcohols, such as being hygroscopic and having the potential to form hydrogen bonds due to the presence of hydroxyl (-OH) groups. It is likely to be a colorless to pale yellow liquid at room temperature, with a relatively low volatility. The presence of the bis(1-methylethyl)amino group suggests that it may have surfactant properties, making it useful in various applications, including as a stabilizer or emulsifier in formulations. Additionally, its solubility in water and organic solvents can facilitate its use in diverse chemical processes. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H21NO2
InChI:InChI=1S/C9H21NO2/c1-7(2)10(8(3)4)5-9(12)6-11/h7-9,11-12H,5-6H2,1-4H3
InChI key:InChIKey=OYYXNGVBOWXTPN-UHFFFAOYSA-N
SMILES:N(CC(CO)O)(C(C)C)C(C)C
Synonyms:- 1,2-Propanediol, 3-(diisopropylamino)-
- 3-[Bis(1-methylethyl)amino]-1,2-propanediol
- 1,2-Propanediol, 3-[bis(1-methylethyl)amino]-
- 3-(Diisopropylamino)-1,2-propanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.