CymitQuimica logo

CAS 85721-31-9

:

3-[Ethyl(phenylmethyl)amino]-1,2-propanediol

Description:
3-[Ethyl(phenylmethyl)amino]-1,2-propanediol, identified by its CAS number 85721-31-9, is an organic compound characterized by its structure, which includes a propanediol backbone with an ethyl and a phenylmethyl group attached to the amino functional group. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents like water. The presence of the ethyl and phenylmethyl groups may impart lipophilicity, affecting its interaction with biological membranes and potential pharmacological activity. Additionally, the compound may exhibit basicity due to the amino group, allowing it to participate in various chemical reactions, including protonation and nucleophilic substitution. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C12H19NO2
InChI:InChI=1S/C12H19NO2/c1-2-13(9-12(15)10-14)8-11-6-4-3-5-7-11/h3-7,12,14-15H,2,8-10H2,1H3
InChI key:InChIKey=BITYXLZZFQSMRP-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC(CO)O)CC
Synonyms:
  • 3-[Ethyl(phenylmethyl)amino]-1,2-propanediol
  • 1,2-Propanediol, 3-[ethyl(phenylmethyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.