
CAS 85723-72-4
:(2R,6R)-1-(3-ammoniopropyl)-2,6-dimethylpiperidinium
Description:
(2R,6R)-1-(3-ammoniopropyl)-2,6-dimethylpiperidinium is a quaternary ammonium compound characterized by its piperidine ring structure, which is substituted at the 1-position with a 3-ammoniopropyl group and at the 2 and 6 positions with methyl groups. This compound is typically a cationic species due to the presence of the quaternary ammonium group, which imparts positive charge and solubility in polar solvents, particularly water. Its stereochemistry, indicated by the (2R,6R) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. Such compounds often exhibit properties relevant to pharmacology, including potential roles as neurotransmitter modulators or in drug delivery systems. The presence of the ammonium group may also enhance its ability to interact with biological membranes or receptors. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and biochemistry.
Formula:C10H24N2
InChI:InChI=1/C10H22N2/c1-9-5-3-6-10(2)12(9)8-4-7-11/h9-10H,3-8,11H2,1-2H3/p+2/t9-,10-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
