CAS 857266-59-2
:tert-Butyl (5-iodopyridin-3-yl)carbamate
Description:
Tert-Butyl (5-iodopyridin-3-yl)carbamate is an organic compound characterized by its functional groups and structural features. It contains a tert-butyl group, which is a bulky alkyl substituent, contributing to its steric properties. The compound features a pyridine ring, specifically substituted at the 3-position with a carbamate group and at the 5-position with an iodine atom, which can influence its reactivity and biological activity. The presence of the iodine atom may enhance the compound's potential for nucleophilic substitution reactions, while the carbamate moiety can participate in hydrogen bonding and may affect solubility and stability. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex structures. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvents used. As with many organic compounds, safety precautions should be taken when handling it, considering potential hazards associated with its components.
Formula:C10H13IN2O2
InChI:InChI=1/C10H13IN2O2/c1-10(2,3)15-9(14)13-8-4-7(11)5-12-6-8/h4-6H,1-3H3,(H,13,14)
SMILES:CC(C)(C)OC(=Nc1cc(cnc1)I)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
