CAS 857283-61-5

4-(Bromomethyl)-2,5-dimethyloxazole

Description:

4-(Bromomethyl)-2,5-dimethyloxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a bromomethyl group indicates that a bromine atom is attached to a methyl group, which is further connected to the oxazole ring, influencing the compound's reactivity and potential applications in organic synthesis. The two methyl groups at the 2 and 5 positions of the oxazole contribute to its hydrophobic character and may affect its solubility in various solvents. This compound is typically used in chemical research and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the electrophilic nature of the bromine atom, making it a useful building block in further chemical transformations. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₆H₈BrNO

InChI: InChI=1S/C6H8BrNO/c1-4-6(3-7)8-5(2)9-4/h3H2,1-2H3

InChI key: InChIKey=SWIPAFLFIFAHEC-UHFFFAOYSA-N

SMILES: C(Br)C1=C(C)OC(C)=N1

Synonyms:

• Oxazole, 4-(bromomethyl)-2,5-dimethyl-
• 4-(Bromomethyl)-2,5-dimethyloxazole

4-(Bromomethyl)-2,5-dimethyl-1,3-oxazole

CAS: 857283-61-5

Versatile small molecule scaffold

Formula: C₆H₈BrNO

Purity: Min. 95%

Molecular weight: 190.04 g/mol

Ref: 3D-HJB28361