CAS 857283-69-3

Thieno[2,3-b]pyrazine-6-carboxaldehyde

Description:

Thieno[2,3-b]pyrazine-6-carboxaldehyde is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyrazine moiety. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the thieno ring system imparts distinct electronic properties, making it a candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound may exhibit interesting biological activities, which can be explored for pharmaceutical development. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in drug discovery. The compound is typically handled with standard laboratory safety precautions, as with many organic compounds, and its stability and solubility characteristics can vary depending on the solvent and conditions used. Overall, Thieno[2,3-b]pyrazine-6-carboxaldehyde represents a versatile building block in the field of organic chemistry.

Formula: C₇H₄N₂OS

InChI: InChI=1S/C7H4N2OS/c10-4-5-3-6-7(11-5)9-2-1-8-6/h1-4H

InChI key: InChIKey=PDSFQJXYTQJKFG-UHFFFAOYSA-N

SMILES: C(=O)C1=CC=2C(S1)=NC=CN2

Synonyms:

• Thieno[2,3-b]pyrazine-6-carboxaldehyde

Thieno[2,3-b]pyrazine-6-carbaldehyde

CAS: 857283-69-3

Formula: C₇H₄N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.1845

Ref: IN-DA004YLH

Thieno[2,3-b]pyrazine-6-carboxaldehyde 97%

CAS: 857283-69-3

Thieno[2,3-b]pyrazine-6-carboxaldehyde 97%

Purity: 98%

Ref: 54-OR9792