CymitQuimica logo

CAS 857283-83-1

:

3-(5-Oxazolyl)benzenemethanamine

Description:
3-(5-Oxazolyl)benzenemethanamine, identified by its CAS number 857283-83-1, is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with a methanamine group and an oxazole ring. The oxazole moiety contributes to its potential biological activity, as oxazoles are often found in various pharmaceuticals and bioactive compounds. This substance may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the presence of functional groups in its structure. The compound's molecular interactions, including hydrogen bonding and π-π stacking, can play a significant role in its behavior in biological systems. Additionally, the presence of the amine group suggests potential for further derivatization, making it a candidate for research in medicinal chemistry. Overall, 3-(5-Oxazolyl)benzenemethanamine is of interest for its potential applications in drug development and its role in various chemical reactions.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c11-5-8-2-1-3-9(4-8)10-6-12-7-13-10/h1-4,6-7H,5,11H2
InChI key:InChIKey=NQWHMXRUVVPQNM-UHFFFAOYSA-N
SMILES:C(N)C=1C=C(C=CC1)C2=CN=CO2
Synonyms:
  • (3-(Oxazol-5-yl)phenyl)methanamine
  • 3-(5-Oxazolyl)benzenemethanamine
  • Benzenemethanamine, 3-(5-oxazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.