CAS 857283-85-3
:5-(2-Furanyl)-3-pyridinecarbonitrile
Description:
5-(2-Furanyl)-3-pyridinecarbonitrile is an organic compound characterized by its unique structural features, which include a pyridine ring and a furan moiety. The presence of the cyano group (-C≡N) at the 3-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate solubility in polar organic solvents, reflecting the influence of its heterocyclic components. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The furan ring can participate in various chemical transformations, while the pyridine nitrogen may engage in coordination with metal ions or hydrogen bonding. Overall, 5-(2-Furanyl)-3-pyridinecarbonitrile is a versatile compound that may serve as a building block in the synthesis of more complex molecules or as a lead compound in pharmacological studies. Its specific properties, such as melting point, boiling point, and spectral data, would require experimental determination or reference to literature for precise characterization.
Formula:C10H6N2O
InChI:InChI=1S/C10H6N2O/c11-5-8-4-9(7-12-6-8)10-2-1-3-13-10/h1-4,6-7H
InChI key:InChIKey=YIVVCSQDWQZPPD-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC=CO2
Synonyms:- 3-Pyridinecarbonitrile, 5-(2-furanyl)-
- 5-(2-Furanyl)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
