CymitQuimica logo

CAS 857283-95-5

:

4-[4-(bromomethyl)phenyl]-2-methyl-1,3-thiazole

Description:
4-[4-(Bromomethyl)phenyl]-2-methyl-1,3-thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a bromomethyl group attached to a phenyl ring, enhancing its reactivity and potential for further chemical modifications. The presence of the methyl group on the thiazole ring contributes to its overall stability and influences its solubility properties. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The bromomethyl group can serve as a useful handle for nucleophilic substitution reactions, allowing for the introduction of various functional groups. Additionally, the thiazole moiety is known for its role in various biological systems, potentially contributing to the compound's pharmacological properties. Overall, this compound's unique structural features suggest it may have applications in synthetic chemistry and pharmaceuticals, although specific biological activities would require further investigation.
Formula:C11H10BrNS
InChI:InChI=1/C11H10BrNS/c1-8-13-11(7-14-8)10-4-2-9(6-12)3-5-10/h2-5,7H,6H2,1H3
SMILES:Cc1nc(cs1)c1ccc(cc1)CBr
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.