CAS 857283-96-6

[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanol

Description:

[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanol, with the CAS number 857283-96-6, is an organic compound characterized by its phenolic structure, which includes a methanol group attached to a phenyl ring that is further substituted with a thiazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The thiazole ring contributes to its biological activity, making it of interest in medicinal chemistry. The compound may display various physical properties, including melting point and boiling point, which are influenced by its molecular structure and intermolecular interactions. Additionally, it may participate in hydrogen bonding due to the hydroxyl group, affecting its solubility and reactivity. Overall, [4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanol is a compound of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₁NOS

InChI: InChI=1/C11H11NOS/c1-8-12-11(7-14-8)10-4-2-9(6-13)3-5-10/h2-5,7,13H,6H2,1H3

SMILES: Cc1nc(cs1)c1ccc(cc1)CO

[4-(2-Methyl-1,3-thiazol-4-yl)phenyl]methanol

CAS: 857283-96-6

[4-(2-Methyl-1,3-thiazol-4-yl)phenyl]methanol

Formula: C₁₁H₁₁NOS

Purity: 97%

Color and Shape: solid

Molecular weight: 205.28g/mol

Ref: 54-OR3820