CAS 857284-12-9

2-Methyl-4-phenyl-5-thiazolemethanol

Description:

2-Methyl-4-phenyl-5-thiazolemethanol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group and a phenyl group, contributing to its unique properties and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the hydroxymethyl group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its potential biological activities, although specific pharmacological data would be necessary to elucidate its therapeutic potential. As with many thiazole derivatives, it may also exhibit properties relevant to materials science or agricultural chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₁NOS

InChI: InChI=1S/C11H11NOS/c1-8-12-11(10(7-13)14-8)9-5-3-2-4-6-9/h2-6,13H,7H2,1H3

InChI key: InChIKey=RBRYERMYEBFVAB-UHFFFAOYSA-N

SMILES: C(O)C1=C(N=C(C)S1)C2=CC=CC=C2

Synonyms:

• 5-Thiazolemethanol, 2-methyl-4-phenyl-
• 2-Methyl-4-phenyl-5-thiazolemethanol
• (2-Methyl-4-phenyl-1,3-thiazol-5-yl)methanol

(2-Methyl-4-phenyl-1,3-thiazol-5-yl)methanol

CAS: 857284-12-9

(2-Methyl-4-phenyl-1,3-thiazol-5-yl)methanol

Purity: ≥95%

Molecular weight: 205.28g/mol

Ref: 54-OR8704