CAS 857284-25-4
:{2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}methanol
Description:
The chemical substance known as {2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}methanol, with the CAS number 857284-25-4, is characterized by its unique structural features, which include a thiazole ring and a trifluoromethyl group. The thiazole moiety contributes to its potential biological activity, often associated with compounds that exhibit antimicrobial or antifungal properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties, making it more effective in penetrating biological membranes. Additionally, the hydroxymethyl group (-CH2OH) provides sites for further chemical modifications, which can be exploited in drug design. This compound may exhibit interesting reactivity due to the electron-withdrawing nature of the trifluoromethyl group, potentially affecting its interaction with various biological targets. Overall, the combination of these functional groups suggests that this substance could be of interest in medicinal chemistry and material science, warranting further investigation into its properties and applications.
Formula:C11H8F3NOS
InChI:InChI=1/C11H8F3NOS/c12-11(13,14)8-3-1-7(2-4-8)10-15-9(5-16)6-17-10/h1-4,6,16H,5H2
SMILES:c1cc(ccc1c1nc(CO)cs1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.