CAS 857356-94-6

di-tert-butyl[3,4,5,6-tetramethyl-2',4',6'-tri(propan-2-yl)biphenyl-2-yl]phosphane

Description:

Di-tert-butyl[3,4,5,6-tetramethyl-2',4',6'-tri(propan-2-yl)biphenyl-2-yl]phosphane is a phosphine compound characterized by its bulky structure, which includes multiple tert-butyl and isopropyl groups. This steric hindrance contributes to its stability and reactivity, making it useful in various chemical applications, particularly in organometallic chemistry and catalysis. The presence of multiple alkyl groups enhances its solubility in organic solvents while also influencing its electronic properties. Phosphines like this one are often employed as ligands in coordination chemistry, where they can stabilize metal complexes. Additionally, the compound's unique structure may impart specific reactivity patterns, making it suitable for selective reactions in synthetic organic chemistry. Its CAS number, 857356-94-6, allows for easy identification and reference in chemical databases. Overall, this compound exemplifies the interplay between sterics and electronics in phosphine chemistry, showcasing its potential in advanced chemical synthesis and catalysis.

Formula: C₃₃H₅₃P

InChI: InChI=1/C33H53P/c1-19(2)26-17-27(20(3)4)30(28(18-26)21(5)6)29-24(9)22(7)23(8)25(10)31(29)34(32(11,12)13)33(14,15)16/h17-21H,1-16H3

SMILES: CC(C)c1cc(C(C)C)c(c(c1)C(C)C)c1c(C)c(C)c(C)c(C)c1P(C(C)(C)C)C(C)(C)C

Synonyms:

• 2-Di-tert-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-triisopropyl-1,1'-biphenyl
• 2-Di-t-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-tri-i-propylbiphenyl
• Me4 t-butylXPhos

2-Di-t-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-tri-i-propyl)-1,1'-biphenyl, min. 98% Me₄ t-BuXPhos

CAS: 857356-94-6

2-Di-t-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-tri-i-propyl)-1,1'-biphenyl, min. 98% Me4 t-BuXPhos

Formula: C₃₃H₅₃P

Purity: min. 98%

Color and Shape: white microxtl.

Molecular weight: 480.75

Ref: 08-15-1051

2-Di-tert-butylphosphino-3,4,5,6-tetramethyl-2′,4′,6′-triisopropyl-1,1′-biphenyl

CAS: 857356-94-6

Formula: C₃₃H₅₃P

Purity: 98%

Color and Shape: Solid

Molecular weight: 480.7477

Ref: IN-DA0033AF

2-Di-Tertbutylphosphino-3,4,5,6-Tetramethyl-2,4,6-Triisopropyl-1,1-Biphenyl

CAS: 857356-94-6

2-Di-Tertbutylphosphino-3,4,5,6-Tetramethyl-2,4,6-Triisopropyl-1,1-Biphenyl

Purity: 98%

Molecular weight: 480.75g/mol

Ref: 54-OR1010423

2-Di-tert-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-triisopropyl-1,1'-biphenyl

CAS: 857356-94-6

2-Di-tert-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-triisopropyl-1,1'-biphenyl is a fine chemical that is useful in research and development as a versatile building block. It is used as an intermediate in the synthesis of other compounds and can serve as a reaction component or reagent. This compound has high purity and can be used in the synthesis of pharmaceuticals and other organic compounds.

Formula: C₃₃H₅₃P

Purity: Min. 95%

Color and Shape: White To Off-White Solid

Molecular weight: 480.75 g/mol

Ref: 3D-FD44693

2-(DI-TERT-BUTYLPHOSPHINO)-3,4,5,6-TETRAMETHYL-2′,4′,6′-TRIISOPROPYL-1,1′-BIPHENYL

CAS: 857356-94-6

Purity: 98%

Color and Shape: Solid

Molecular weight: 480.7609863

Ref: 10-F799904