CAS 857486-15-8

2-amino-N-(2-morpholin-4-ylethyl)benzamide

Description:

2-amino-N-(2-morpholin-4-ylethyl)benzamide is a chemical compound characterized by its amine and amide functional groups, which contribute to its potential biological activity. The presence of the morpholine ring enhances its solubility and may influence its interaction with biological targets. This compound typically exhibits moderate polarity due to the combination of hydrophilic amine and amide groups and a hydrophobic aromatic benzene ring. It may participate in hydrogen bonding, which can affect its pharmacokinetic properties, such as absorption and distribution. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the compound's specific stereochemistry and substituent positions can significantly influence its reactivity and biological efficacy. As with many compounds containing nitrogen heterocycles, it may also exhibit basic properties, allowing it to interact with acidic environments in biological systems. Overall, 2-amino-N-(2-morpholin-4-ylethyl)benzamide represents a versatile scaffold for further chemical modifications and investigations in drug discovery.

Formula: C₁₃H₁₉N₃O₂

InChI: InChI=1/C13H19N3O2/c14-12-4-2-1-3-11(12)13(17)15-5-6-16-7-9-18-10-8-16/h1-4H,5-10,14H2,(H,15,17)

SMILES: c1ccc(c(c1)C(=NCCN1CCOCC1)O)N

Synonyms:

• benzamide, 2-amino-N-[2-(4-morpholinyl)ethyl]-

2-amino-N-[2-(4-morpholinyl)ethyl]benzamide

CAS: 857486-15-8

Formula: C₁₃H₁₉N₃O₂

Purity: 95.0%

Molecular weight: 249.314

Ref: 10-F315663