CAS 857487-21-9

4-Ethoxy-3-nitrobenzamide

Description:

4-Ethoxy-3-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a nitro group and an ethoxy substituent on a benzene ring. The presence of the nitro group (-NO2) typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The ethoxy group (-OCH2CH3) enhances the solubility of the compound in organic solvents and may affect its biological activity. This compound is likely to exhibit moderate to high stability under standard conditions but may be sensitive to strong acids or bases. Its applications could span across pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, depending on its specific properties and reactivity. Additionally, the compound's molecular structure suggests potential interactions with biological systems, which could be explored for medicinal chemistry purposes. As with any chemical substance, proper handling and safety precautions are essential due to potential toxicity or environmental impact.

Formula: C₉H₁₀N₂O₄

InChI: InChI=1S/C9H10N2O4/c1-2-15-8-4-3-6(9(10)12)5-7(8)11(13)14/h3-5H,2H2,1H3,(H2,10,12)

InChI key: InChIKey=NALXYPQJOSZBRA-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(OCC)C=CC(C(N)=O)=C1

Synonyms:

• 4-Ethoxy-3-nitrobenzamide
• Benzamide, 4-ethoxy-3-nitro-