CAS 85750-08-9

Ethyl 5-chloro-2-oxo-3(2H)-benzothiazoleacetate

Description:

Ethyl 5-chloro-2-oxo-3(2H)-benzothiazoleacetate is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with an ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the chloro and carbonyl groups. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the chloro substituent can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which can be explored for potential applications in medicinal chemistry. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards. Proper storage and disposal methods are essential to ensure safety and compliance with regulatory standards.

Formula: C₁₁H₁₀ClNO₃S

InChI: InChI=1S/C11H10ClNO3S/c1-2-16-10(14)6-13-8-5-7(12)3-4-9(8)17-11(13)15/h3-5H,2,6H2,1H3

InChI key: InChIKey=OYYYOYUUAGTANC-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)N1C=2C(SC1=O)=CC=C(Cl)C2

Synonyms:

• 3(2H)-Benzothiazoleacetic acid, 5-chloro-2-oxo-, ethyl ester
• Ethyl 5-chloro-2-oxo-3(2H)-benzothiazoleacetate
• 3-Benzothiazolineacetic acid, 5-chloro-2-oxo-, ethyl ester

3(2H)-Benzothiazoleaceticacid, 5-chloro-2-oxo-, ethyl ester

CAS: 85750-08-9

Formula: C₁₁H₁₀ClNO₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 271.7200

Ref: IN-DA004YA3

Ethyl 2-(5-chloro-2-oxobenzo[d]thiazol-3(2H)-yl)acetate

CAS: 85750-08-9

Ethyl 2-(5-chloro-2-oxobenzo[d]thiazol-3(2H)-yl)acetate

Purity: 98%

Molecular weight: 271.73g/mol

Ref: 54-OR1063142