CAS 85750-24-9
:α-(4-Bromophenyl)-2-pyridineacetonitrile
Description:
α-(4-Bromophenyl)-2-pyridineacetonitrile, with the CAS number 85750-24-9, is an organic compound characterized by its unique structural features, which include a pyridine ring and a bromophenyl group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The nitrile functional group (-C≡N) contributes to its polarity and can influence its solubility in different solvents. Additionally, the compound may exhibit biological activity, which can be explored in pharmacological studies. Its synthesis generally involves the reaction of appropriate precursors under controlled conditions, and it is important to handle this compound with care due to the presence of bromine, which can pose health and environmental risks. Overall, α-(4-Bromophenyl)-2-pyridineacetonitrile is a significant compound in the field of organic chemistry with diverse applications.
Formula:C13H9BrN2
InChI:InChI=1S/C13H9BrN2/c14-11-6-4-10(5-7-11)12(9-15)13-3-1-2-8-16-13/h1-8,12H
InChI key:InChIKey=PMKCUNAECONNCQ-UHFFFAOYSA-N
SMILES:C(C#N)(C1=CC=C(Br)C=C1)C2=CC=CC=N2
Synonyms:- 2-(4-Bromophenyl)-2-(2-Pyridyl)Acetonitrile
- 2-(4-Bromophenyl)-2-(pyridin-2-yl)acetonitrile
- 2-(4-Bromophenyl)-2-pyridin-2-ylacetonitrile
- 2-Pyridineacetonitrile, α-(4-bromophenyl)-
- alpha-(4-Bromophenyl)pyridine-2-acetonitrile
- α-(4-Bromophenyl)-2-pyridineacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Alpha-(4-Bromophenyl)-2-pyridineacetonitrile
CAS:Controlled ProductApplications α-(4-Bromophenyl)-2-pyridineacetonitrile, is an intermediate in the synthesis of Bromopheniramine Maleate, a derivative of Pheniramine (P297200), used to treat allergic conditions such as hay fever or urticaria.
References Dadkar, N.K. et al.: Psychopharmacology, 48, 7 (1976); Jancinova, V. et al.: Inflam. Res., 44, 183 (1997); Radke, R.S. et al.: Ind. Pharm., 8, 69 (2009);Formula:C13H9BrN2Color and Shape:NeatMolecular weight:273.13


