
CAS 857521-47-2
:4-(3-Aminopropyl)-α-(trifluoromethyl)benzenemethanol
Description:
4-(3-Aminopropyl)-α-(trifluoromethyl)benzenemethanol, with the CAS number 857521-47-2, is a chemical compound characterized by its unique structural features. It contains a trifluoromethyl group, which enhances its lipophilicity and can influence its biological activity. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. The benzenemethanol moiety indicates that it may exhibit properties typical of alcohols, such as solubility in polar solvents. This compound may also possess pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its trifluoromethyl group can impart unique electronic properties, affecting its interaction with biological targets. Overall, the combination of these functional groups suggests that this compound could be of interest in the development of pharmaceuticals or agrochemicals, although specific biological activities would need to be investigated through empirical studies.
Formula:C11H14F3NO
InChI:InChI=1S/C11H14F3NO/c12-11(13,14)10(16)9-5-3-8(4-6-9)2-1-7-15/h3-6,10,16H,1-2,7,15H2
InChI key:InChIKey=DHYHLHRLJYVMKI-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1=CC=C(CCCN)C=C1
Synonyms:- 1-[4-(3-Aminopropyl)phenyl]-2,2,2-trifluoroethanol
- 4-(3-Aminopropyl)-α-(trifluoromethyl)benzenemethanol
- Benzenemethanol, 4-(3-aminopropyl)-α-(trifluoromethyl)-
- 1-[4-(3-Aminopropyl)phenyl]-2,2,2-trifluoroethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.