CAS 857599-38-3
:2-Hydroxy-3-methoxy-5-(1-propen-1-yl)benzoic acid
Description:
2-Hydroxy-3-methoxy-5-(1-propen-1-yl)benzoic acid, also known by its CAS number 857599-38-3, is an organic compound that belongs to the class of benzoic acids. This substance features a benzoic acid core with several functional groups, including a hydroxyl (-OH) group, a methoxy (-OCH3) group, and a propenyl side chain. The presence of the hydroxyl group contributes to its acidity, while the methoxy group can influence its solubility and reactivity. The propenyl group introduces unsaturation, which may affect the compound's stability and reactivity in various chemical reactions. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex organic molecules. Its structural characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-3-4-7-5-8(11(13)14)10(12)9(6-7)15-2/h3-6,12H,1-2H3,(H,13,14)
InChI key:InChIKey=CZKYVNLEHLLDSY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C(OC)=CC(C=CC)=C1
Synonyms:- 2-Hydroxy-3-methoxy-5-(1-propen-1-yl)benzoic acid
- Benzoic acid, 2-hydroxy-3-methoxy-5-(1-propen-1-yl)-
- m-Anisic acid, 2-hydroxy-5-propenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
