CAS 85761-30-4

3,7,11,15-Tetramethyl-3-hexadecanol

Description:

3,7,11,15-Tetramethyl-3-hexadecanol, with the CAS number 85761-30-4, is a long-chain alcohol characterized by its branched structure. This compound features a hydroxyl (-OH) functional group attached to a hexadecane backbone, which is further substituted with four methyl groups at the 3, 7, 11, and 15 positions. As a result of its structure, it exhibits hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the hydroxyl group imparts some polar characteristics, allowing for potential interactions with other polar molecules. This compound is typically used in various applications, including as a surfactant, emulsifier, or in the formulation of personal care products due to its ability to enhance texture and stability. Additionally, its branched nature contributes to lower melting and boiling points compared to straight-chain alcohols of similar molecular weight. Overall, 3,7,11,15-Tetramethyl-3-hexadecanol is notable for its unique structural features and functional properties that make it valuable in industrial and consumer applications.

Formula: C₂₀H₄₂O

InChI: InChI=1S/C20H42O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h17-19,21H,7-16H2,1-6H3

InChI key: InChIKey=CVPIIXFZNPKANT-UHFFFAOYSA-N

SMILES: C(CC(CC)(C)O)CC(CCCC(CCCC(C)C)C)C

Synonyms:

• 3-Hexadecanol, 3,7,11,15-tetramethyl-
• 3,7,11,15-Tetramethyl-3-hexadecanol
• 3,7,11,15-Tetramethylhexadecan-3-ol

Vitamin K1 Impurity 44

CAS: 85761-30-4

Formula: C₂₀H₄₂O

Molecular weight: 298.56

Ref: 4Z-V-1468